C10H17NO2 — CID 123179464
2-ethenyl-4,5-dimethoxyhexa-2,4-dien-1-amine (PubChem CID 123179464) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-ethenyl-4,5-dimethoxyhexa-2,4-dien-1-amine.
| Compound Name | 2-ethenyl-4,5-dimethoxyhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123179464 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-ethenyl-4,5-dimethoxyhexa-2,4-dien-1-amine |
| SMILES | C=CC(=CC(OC)=C(C)OC)CN |
| InChI | InChI=1S/C10H17NO2/c1-5-9(7-11)6-10(13-4)8(2)12-3/h5-6H,1,7,11H2,2-4H3 |
| InChIKey | YFHKUYSNBGTEPR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|