C10H16FNO — CID 123394914
3-fluoro-2-(hexa-2,4-dien-2-yloxymethyl)prop-2-en-1-amine (PubChem CID 123394914) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is 3-fluoro-2-(hexa-2,4-dien-2-yloxymethyl)prop-2-en-1-amine.
| Compound Name | 3-fluoro-2-(hexa-2,4-dien-2-yloxymethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 123394914 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-fluoro-2-(hexa-2,4-dien-2-yloxymethyl)prop-2-en-1-amine |
| SMILES | CC=CC=C(C)OCC(=CF)CN |
| InChI | InChI=1S/C10H16FNO/c1-3-4-5-9(2)13-8-10(6-11)7-12/h3-6H,7-8,12H2,1-2H3 |
| InChIKey | DRJPELNIWJNWSC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|