C11H20FNO — CID 143673829
ethane;(2Z)-2-ethenyl-3-ethoxy-4-fluoropenta-2,4-dien-1-amine (PubChem CID 143673829) has the molecular formula C11H20FNO and a molecular weight of 201.28 g/mol. Its IUPAC name is ethane;(2Z)-2-ethenyl-3-ethoxy-4-fluoropenta-2,4-dien-1-amine.
| Compound Name | ethane;(2Z)-2-ethenyl-3-ethoxy-4-fluoropenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143673829 |
| Molecular Formula | C11H20FNO |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | ethane;(2Z)-2-ethenyl-3-ethoxy-4-fluoropenta-2,4-dien-1-amine |
| SMILES | C=C/C(CN)=C(/OCC)C(=C)F.CC |
| InChI | InChI=1S/C9H14FNO.C2H6/c1-4-8(6-11)9(7(3)10)12-5-2;1-2/h4H,1,3,5-6,11H2,2H3;1-2H3/b9-8-; |
| InChIKey | NNLGVRIQCLPXST-UOQXYWCXSA-N |
| XLogP | 2.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|