C13H16FNO — CID 143911634
(2E)-2-[(E)-2-[(1E,3E)-4-fluorohexa-1,3,5-trienoxy]ethenyl]penta-2,4-dien-1-amine (PubChem CID 143911634) has the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. Its IUPAC name is (2E)-2-[(E)-2-[(1E,3E)-4-fluorohexa-1,3,5-trienoxy]ethenyl]penta-2,4-dien-1-amine.
| Compound Name | (2E)-2-[(E)-2-[(1E,3E)-4-fluorohexa-1,3,5-trienoxy]ethenyl]penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143911634 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (2E)-2-[(E)-2-[(1E,3E)-4-fluorohexa-1,3,5-trienoxy]ethenyl]penta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C=C\O/C=C/C=C(/F)C=C)CN |
| InChI | InChI=1S/C13H16FNO/c1-3-6-12(11-15)8-10-16-9-5-7-13(14)4-2/h3-10H,1-2,11,15H2/b9-5+,10-8+,12-6+,13-7+ |
| InChIKey | DGNVDIXNSMYJTP-QEAVOWQUSA-N |
| XLogP | 3.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|