C10H14F3NO — CID 143689086
(2Z)-2-ethenyl-3-(1,1,2-trifluoropropan-2-yloxy)penta-2,4-dien-1-amine (PubChem CID 143689086) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is (2Z)-2-ethenyl-3-(1,1,2-trifluoropropan-2-yloxy)penta-2,4-dien-1-amine.
| Compound Name | (2Z)-2-ethenyl-3-(1,1,2-trifluoropropan-2-yloxy)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143689086 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (2Z)-2-ethenyl-3-(1,1,2-trifluoropropan-2-yloxy)penta-2,4-dien-1-amine |
| SMILES | C=C/C(CN)=C(\C=C)OC(C)(F)C(F)F |
| InChI | InChI=1S/C10H14F3NO/c1-4-7(6-14)8(5-2)15-10(3,13)9(11)12/h4-5,9H,1-2,6,14H2,3H3/b8-7- |
| InChIKey | DLOBQAUZHVNJDX-FPLPWBNLSA-N |
| XLogP | 2.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|