C17H16Cl2N2O3 — CID 11574180
7,8-dichloro-N-[2-(dimethylamino)ethyl]dibenzo-p-dioxin-1-carboxamide (PubChem CID 11574180) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is 7,8-dichloro-N-[2-(dimethylamino)ethyl]dibenzo-p-dioxin-1-carboxamide.
| Compound Name | 7,8-dichloro-N-[2-(dimethylamino)ethyl]dibenzo-p-dioxin-1-carboxamide |
|---|---|
| PubChem CID | 11574180 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 7,8-dichloro-N-[2-(dimethylamino)ethyl]dibenzo-p-dioxin-1-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cccc2c1Oc1cc(Cl)c(Cl)cc1O2 |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-21(2)7-6-20-17(22)10-4-3-5-13-16(10)24-15-9-12(19)11(18)8-14(15)23-13/h3-5,8-9H,6-7H2,1-2H3,(H,20,22) |
| InChIKey | QUAUTJNPSHMSKO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |