C17H30N2S — CID 115741995
N-[(5-tert-butylthiophen-2-yl)methyl]-2-(1-methylpiperidin-4-yl)ethanamine (PubChem CID 115741995) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is N-[(5-tert-butylthiophen-2-yl)methyl]-2-(1-methylpiperidin-4-yl)ethanamine.
| Compound Name | N-[(5-tert-butylthiophen-2-yl)methyl]-2-(1-methylpiperidin-4-yl)ethanamine |
|---|---|
| PubChem CID | 115741995 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-[(5-tert-butylthiophen-2-yl)methyl]-2-(1-methylpiperidin-4-yl)ethanamine |
| SMILES | CN1CCC(CCNCc2ccc(C(C)(C)C)s2)CC1 |
| InChI | InChI=1S/C17H30N2S/c1-17(2,3)16-6-5-15(20-16)13-18-10-7-14-8-11-19(4)12-9-14/h5-6,14,18H,7-13H2,1-4H3 |
| InChIKey | KXNBNENXNCBOHL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|