C13H17NO — CID 115742737
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-methylaniline (PubChem CID 115742737) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-methylaniline.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-methylaniline |
|---|---|
| PubChem CID | 115742737 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-methylaniline |
| SMILES | Cc1ccccc1NCC1=CCCOC1 |
| InChI | InChI=1S/C13H17NO/c1-11-5-2-3-7-13(11)14-9-12-6-4-8-15-10-12/h2-3,5-7,14H,4,8-10H2,1H3 |
| InChIKey | GQVLSAKMZHHOIL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|