C12H15IO6 — CID 11574489
ethyl (1R,4S,5R)-4-(2-ethoxy-2-oxoethyl)-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 11574489) has the molecular formula C12H15IO6 and a molecular weight of 382.15 g/mol. Its IUPAC name is ethyl (1R,4S,5R)-4-(2-ethoxy-2-oxoethyl)-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | ethyl (1R,4S,5R)-4-(2-ethoxy-2-oxoethyl)-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 11574489 |
| Molecular Formula | C12H15IO6 |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | ethyl (1R,4S,5R)-4-(2-ethoxy-2-oxoethyl)-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CCOC(=O)C[C@@H]1OC(=O)[C@]2(C(=O)OCC)C[C@]12I |
| InChI | InChI=1S/C12H15IO6/c1-3-17-8(14)5-7-12(13)6-11(12,10(16)19-7)9(15)18-4-2/h7H,3-6H2,1-2H3/t7-,11+,12-/m0/s1 |
| InChIKey | IRURXKKJWQPYOP-BPTDKIDVSA-N |
| XLogP | 0.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|