C12H19IO4Si — CID 11516480
methyl (1R,4S,5R)-4-ethyl-5-iodo-2-oxo-4-trimethylsilyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 11516480) has the molecular formula C12H19IO4Si and a molecular weight of 382.27 g/mol. Its IUPAC name is methyl (1R,4S,5R)-4-ethyl-5-iodo-2-oxo-4-trimethylsilyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl (1R,4S,5R)-4-ethyl-5-iodo-2-oxo-4-trimethylsilyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 11516480 |
| Molecular Formula | C12H19IO4Si |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | methyl (1R,4S,5R)-4-ethyl-5-iodo-2-oxo-4-trimethylsilyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CC[C@@]1([Si](C)(C)C)OC(=O)[C@]2(C(=O)OC)C[C@@]21I |
| InChI | InChI=1S/C12H19IO4Si/c1-6-12(18(3,4)5)11(13)7-10(11,8(14)16-2)9(15)17-12/h6-7H2,1-5H3/t10-,11-,12+/m1/s1 |
| InChIKey | YXPGLZPCDHDSEO-UTUOFQBUSA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|