C15H23IO4 — CID 11639791
ethyl (1R,4S,5R)-4-heptyl-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 11639791) has the molecular formula C15H23IO4 and a molecular weight of 394.25 g/mol. Its IUPAC name is ethyl (1R,4S,5R)-4-heptyl-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | ethyl (1R,4S,5R)-4-heptyl-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 11639791 |
| Molecular Formula | C15H23IO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | ethyl (1R,4S,5R)-4-heptyl-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CCCCCCC[C@@H]1OC(=O)[C@]2(C(=O)OCC)C[C@]12I |
| InChI | InChI=1S/C15H23IO4/c1-3-5-6-7-8-9-11-15(16)10-14(15,13(18)20-11)12(17)19-4-2/h11H,3-10H2,1-2H3/t11-,14+,15-/m0/s1 |
| InChIKey | ZSKQZHHQTFEPOW-GLQYFDAESA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|