C12H15IO4 — CID 11617231
methyl (1R,5R)-5-iodo-2-oxospiro[3-oxabicyclo[3.1.0]hexane-4,1'-cyclohexane]-1-carboxylate (PubChem CID 11617231) has the molecular formula C12H15IO4 and a molecular weight of 350.15 g/mol. Its IUPAC name is methyl (1R,5R)-5-iodo-2-oxospiro[3-oxabicyclo[3.1.0]hexane-4,1'-cyclohexane]-1-carboxylate.
| Compound Name | methyl (1R,5R)-5-iodo-2-oxospiro[3-oxabicyclo[3.1.0]hexane-4,1'-cyclohexane]-1-carboxylate |
|---|---|
| PubChem CID | 11617231 |
| Molecular Formula | C12H15IO4 |
| Molecular Weight | 350.15 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | methyl (1R,5R)-5-iodo-2-oxospiro[3-oxabicyclo[3.1.0]hexane-4,1'-cyclohexane]-1-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@]1(I)C1(CCCCC1)OC2=O |
| InChI | InChI=1S/C12H15IO4/c1-16-8(14)11-7-12(11,13)10(17-9(11)15)5-3-2-4-6-10/h2-7H2,1H3/t11-,12+/m1/s1 |
| InChIKey | DERDTSDJFIINEH-NEPJUHHUSA-N |
| XLogP | 1.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|