C11H15IO4 — CID 11652967
methyl (1R,4S,5R)-4-butyl-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 11652967) has the molecular formula C11H15IO4 and a molecular weight of 338.14 g/mol. Its IUPAC name is methyl (1R,4S,5R)-4-butyl-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl (1R,4S,5R)-4-butyl-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 11652967 |
| Molecular Formula | C11H15IO4 |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | methyl (1R,4S,5R)-4-butyl-5-iodo-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CCCC[C@@H]1OC(=O)[C@]2(C(=O)OC)C[C@]12I |
| InChI | InChI=1S/C11H15IO4/c1-3-4-5-7-11(12)6-10(11,8(13)15-2)9(14)16-7/h7H,3-6H2,1-2H3/t7-,10+,11-/m0/s1 |
| InChIKey | QUWGYKSIFIIQSZ-XROYCOCOSA-N |
| XLogP | 1.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|