C7H12N2OS — CID 115749761
3-[2-(dimethylamino)ethyl]-1,3-thiazol-2-one (PubChem CID 115749761) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1,3-thiazol-2-one.
| Compound Name | 3-[2-(dimethylamino)ethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115749761 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1,3-thiazol-2-one |
| SMILES | CN(C)CCn1ccsc1=O |
| InChI | InChI=1S/C7H12N2OS/c1-8(2)3-4-9-5-6-11-7(9)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | YNBSZNMKXFKJQB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |