About N-ethyl-2,2-dimethylpiperazine-1-sulfonamide
N-ethyl-2,2-dimethylpiperazine-1-sulfonamide (PubChem CID 115752522) has the molecular formula C8H19N3O2S
and a molecular weight of 221.33 g/mol. Its IUPAC name is N-ethyl-2,2-dimethylpiperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-2,2-dimethylpiperazine-1-sulfonamide |
| PubChem CID | 115752522 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-ethyl-2,2-dimethylpiperazine-1-sulfonamide |
| SMILES | CCNS(=O)(=O)N1CCNCC1(C)C |
| InChI | InChI=1S/C8H19N3O2S/c1-4-10-14(12,13)11-6-5-9-7-8(11,2)3/h9-10H,4-7H2,1-3H3 |
| InChIKey | BJMMMEQHACQMTH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2,2-dimethylpiperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,2-dimethylpiperazine-1-sulfonamide?
The IUPAC name of N-ethyl-2,2-dimethylpiperazine-1-sulfonamide (CID 115752522) is N-ethyl-2,2-dimethylpiperazine-1-sulfonamide.
What is the SMILES notation for N-ethyl-2,2-dimethylpiperazine-1-sulfonamide?
The canonical SMILES for N-ethyl-2,2-dimethylpiperazine-1-sulfonamide is CCNS(=O)(=O)N1CCNCC1(C)C.
What is the InChIKey of N-ethyl-2,2-dimethylpiperazine-1-sulfonamide?
The InChIKey is BJMMMEQHACQMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3O2S/c1-4-10-14(12,13)11-6-5-9-7-8(11,2)3/h9-10H,4-7H2,1-3H3.
What are the key properties of N-ethyl-2,2-dimethylpiperazine-1-sulfonamide?
N-ethyl-2,2-dimethylpiperazine-1-sulfonamide has a molecular weight of 221.33 g/mol, XLogP of -0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,2-dimethylpiperazine-1-sulfonamide is sourced from PubChem (CID 115752522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).