C9H19N3O2S — CID 114810920
N-cyclopropyl-2,2-dimethylpiperazine-1-sulfonamide (PubChem CID 114810920) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-cyclopropyl-2,2-dimethylpiperazine-1-sulfonamide.
| Compound Name | N-cyclopropyl-2,2-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 114810920 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-cyclopropyl-2,2-dimethylpiperazine-1-sulfonamide |
| SMILES | CC1(C)CNCCN1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C9H19N3O2S/c1-9(2)7-10-5-6-12(9)15(13,14)11-8-3-4-8/h8,10-11H,3-7H2,1-2H3 |
| InChIKey | ABTAHDCJKXPKMT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |