C9H20N2O4S2 — CID 65460748
2,2-dimethyl-1-(2-methylsulfonylethylsulfonyl)piperazine (PubChem CID 65460748) has the molecular formula C9H20N2O4S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2-methylsulfonylethylsulfonyl)piperazine.
| Compound Name | 2,2-dimethyl-1-(2-methylsulfonylethylsulfonyl)piperazine |
|---|---|
| PubChem CID | 65460748 |
| Molecular Formula | C9H20N2O4S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2,2-dimethyl-1-(2-methylsulfonylethylsulfonyl)piperazine |
| SMILES | CC1(C)CNCCN1S(=O)(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C9H20N2O4S2/c1-9(2)8-10-4-5-11(9)17(14,15)7-6-16(3,12)13/h10H,4-8H2,1-3H3 |
| InChIKey | ILNPZSIBFSEISQ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |