C12H15F3N2O2S — CID 65462962
2,2-dimethyl-1-(2,4,6-trifluorophenyl)sulfonylpiperazine (PubChem CID 65462962) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2,4,6-trifluorophenyl)sulfonylpiperazine.
| Compound Name | 2,2-dimethyl-1-(2,4,6-trifluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 65462962 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2,2-dimethyl-1-(2,4,6-trifluorophenyl)sulfonylpiperazine |
| SMILES | CC1(C)CNCCN1S(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O2S/c1-12(2)7-16-3-4-17(12)20(18,19)11-9(14)5-8(13)6-10(11)15/h5-6,16H,3-4,7H2,1-2H3 |
| InChIKey | BVFKZGIQIUBQIV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |