C13H19FN2O3S — CID 65463372
1-(3-fluoro-4-methoxyphenyl)sulfonyl-2,2-dimethylpiperazine (PubChem CID 65463372) has the molecular formula C13H19FN2O3S and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)sulfonyl-2,2-dimethylpiperazine.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)sulfonyl-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 65463372 |
| Molecular Formula | C13H19FN2O3S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)sulfonyl-2,2-dimethylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCNCC2(C)C)cc1F |
| InChI | InChI=1S/C13H19FN2O3S/c1-13(2)9-15-6-7-16(13)20(17,18)10-4-5-12(19-3)11(14)8-10/h4-5,8,15H,6-7,9H2,1-3H3 |
| InChIKey | DRSHAKHKKGYQSQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |