C16H19FN2O4S — CID 110223837
8-(3-fluoro-4-methoxyphenyl)sulfonyl-2,8-diazaspiro[5.5]undec-3-en-1-one (PubChem CID 110223837) has the molecular formula C16H19FN2O4S and a molecular weight of 354.40 g/mol. Its IUPAC name is 8-(3-fluoro-4-methoxyphenyl)sulfonyl-2,8-diazaspiro[5.5]undec-3-en-1-one.
| Compound Name | 8-(3-fluoro-4-methoxyphenyl)sulfonyl-2,8-diazaspiro[5.5]undec-3-en-1-one |
|---|---|
| PubChem CID | 110223837 |
| Molecular Formula | C16H19FN2O4S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 8-(3-fluoro-4-methoxyphenyl)sulfonyl-2,8-diazaspiro[5.5]undec-3-en-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC3(CC=CNC3=O)C2)cc1F |
| InChI | InChI=1S/C16H19FN2O4S/c1-23-14-5-4-12(10-13(14)17)24(21,22)19-9-3-7-16(11-19)6-2-8-18-15(16)20/h2,4-5,8,10H,3,6-7,9,11H2,1H3,(H,18,20) |
| InChIKey | LPWMRLKSXFLRTJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |