C14H19NO5S — CID 115754620
methyl 3-[[2-hydroxyethyl(prop-2-enyl)sulfamoyl]methyl]benzoate (PubChem CID 115754620) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 3-[[2-hydroxyethyl(prop-2-enyl)sulfamoyl]methyl]benzoate.
| Compound Name | methyl 3-[[2-hydroxyethyl(prop-2-enyl)sulfamoyl]methyl]benzoate |
|---|---|
| PubChem CID | 115754620 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | methyl 3-[[2-hydroxyethyl(prop-2-enyl)sulfamoyl]methyl]benzoate |
| SMILES | C=CCN(CCO)S(=O)(=O)Cc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C14H19NO5S/c1-3-7-15(8-9-16)21(18,19)11-12-5-4-6-13(10-12)14(17)20-2/h3-6,10,16H,1,7-9,11H2,2H3 |
| InChIKey | HCSZNAUNKLNEJK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|