C24H28N4O4 — CID 11575730
tert-butyl (4S)-5-azido-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate (PubChem CID 11575730) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is tert-butyl (4S)-5-azido-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl (4S)-5-azido-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 11575730 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | tert-butyl (4S)-5-azido-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](CN=[N+]=[N-])NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H28N4O4/c1-24(2,3)32-22(29)13-12-16(14-26-28-25)27-23(30)31-15-21-19-10-6-4-8-17(19)18-9-5-7-11-20(18)21/h4-11,16,21H,12-15H2,1-3H3,(H,27,30)/t16-/m0/s1 |
| InChIKey | KEVCFYXYMGZMCU-INIZCTEOSA-N |
| XLogP | 5.33 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|