C13H18N2O — CID 115757929
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylpyridin-2-amine (PubChem CID 115757929) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylpyridin-2-amine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 115757929 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-3-ethylpyridin-2-amine |
| SMILES | CCc1cccnc1NCC1=CCCOC1 |
| InChI | InChI=1S/C13H18N2O/c1-2-12-6-3-7-14-13(12)15-9-11-5-4-8-16-10-11/h3,5-7H,2,4,8-10H2,1H3,(H,14,15) |
| InChIKey | CPIYOTFXNZOFSV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|