C16H23NO3 — CID 115758676
methyl 3-[[(1-hydroxycyclopentyl)methyl-methylamino]methyl]benzoate (PubChem CID 115758676) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is methyl 3-[[(1-hydroxycyclopentyl)methyl-methylamino]methyl]benzoate.
| Compound Name | methyl 3-[[(1-hydroxycyclopentyl)methyl-methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 115758676 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | methyl 3-[[(1-hydroxycyclopentyl)methyl-methylamino]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN(C)CC2(O)CCCC2)c1 |
| InChI | InChI=1S/C16H23NO3/c1-17(12-16(19)8-3-4-9-16)11-13-6-5-7-14(10-13)15(18)20-2/h5-7,10,19H,3-4,8-9,11-12H2,1-2H3 |
| InChIKey | PNRNRVVROSOXIO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |