C16H24Cl2N2O2 — CID 167864686
methyl 3-[[methyl-[(5-methyl-1,2-dihydropyrrol-5-yl)methyl]amino]methyl]benzoate;dihydrochloride (PubChem CID 167864686) has the molecular formula C16H24Cl2N2O2 and a molecular weight of 347.29 g/mol. Its IUPAC name is methyl 3-[[methyl-[(5-methyl-1,2-dihydropyrrol-5-yl)methyl]amino]methyl]benzoate;dihydrochloride.
| Compound Name | methyl 3-[[methyl-[(5-methyl-1,2-dihydropyrrol-5-yl)methyl]amino]methyl]benzoate;dihydrochloride |
|---|---|
| PubChem CID | 167864686 |
| Molecular Formula | C16H24Cl2N2O2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | methyl 3-[[methyl-[(5-methyl-1,2-dihydropyrrol-5-yl)methyl]amino]methyl]benzoate;dihydrochloride |
| SMILES | COC(=O)c1cccc(CN(C)CC2(C)C=CCN2)c1.Cl.Cl |
| InChI | InChI=1S/C16H22N2O2.2ClH/c1-16(8-5-9-17-16)12-18(2)11-13-6-4-7-14(10-13)15(19)20-3;;/h4-8,10,17H,9,11-12H2,1-3H3;2*1H |
| InChIKey | CXUXILUQPKLEDY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|