C13H23NO2 — CID 115763781
2-(3,6-dihydro-2H-pyran-4-yl)-N-(oxan-4-ylmethyl)ethanamine (PubChem CID 115763781) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyran-4-yl)-N-(oxan-4-ylmethyl)ethanamine.
| Compound Name | 2-(3,6-dihydro-2H-pyran-4-yl)-N-(oxan-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115763781 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyran-4-yl)-N-(oxan-4-ylmethyl)ethanamine |
| SMILES | C1=C(CCNCC2CCOCC2)CCOC1 |
| InChI | InChI=1S/C13H23NO2/c1(12-2-7-15-8-3-12)6-14-11-13-4-9-16-10-5-13/h2,13-14H,1,3-11H2 |
| InChIKey | RDNPPUVUGLDSBW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|