C10H17NO2S2 — CID 115764056
N-[(5-methoxythiophen-2-yl)methyl]-2-methylsulfinylpropan-1-amine (PubChem CID 115764056) has the molecular formula C10H17NO2S2 and a molecular weight of 247.38 g/mol. Its IUPAC name is N-[(5-methoxythiophen-2-yl)methyl]-2-methylsulfinylpropan-1-amine.
| Compound Name | N-[(5-methoxythiophen-2-yl)methyl]-2-methylsulfinylpropan-1-amine |
|---|---|
| PubChem CID | 115764056 |
| Molecular Formula | C10H17NO2S2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-[(5-methoxythiophen-2-yl)methyl]-2-methylsulfinylpropan-1-amine |
| SMILES | COc1ccc(CNCC(C)S(C)=O)s1 |
| InChI | InChI=1S/C10H17NO2S2/c1-8(15(3)12)6-11-7-9-4-5-10(13-2)14-9/h4-5,8,11H,6-7H2,1-3H3 |
| InChIKey | CHTBLLXRVXAOPR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |