C9H14ClNOS2 — CID 115763950
N-[(5-chlorothiophen-2-yl)methyl]-2-methylsulfinylpropan-1-amine (PubChem CID 115763950) has the molecular formula C9H14ClNOS2 and a molecular weight of 251.80 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-methylsulfinylpropan-1-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-methylsulfinylpropan-1-amine |
|---|---|
| PubChem CID | 115763950 |
| Molecular Formula | C9H14ClNOS2 |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-methylsulfinylpropan-1-amine |
| SMILES | CC(CNCc1ccc(Cl)s1)S(C)=O |
| InChI | InChI=1S/C9H14ClNOS2/c1-7(14(2)12)5-11-6-8-3-4-9(10)13-8/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | RIHKFZCYNVEIQC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |