C12H16F3NOS2 — CID 115764125
2-methylsulfinyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]propan-1-amine (PubChem CID 115764125) has the molecular formula C12H16F3NOS2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-methylsulfinyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]propan-1-amine.
| Compound Name | 2-methylsulfinyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 115764125 |
| Molecular Formula | C12H16F3NOS2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-methylsulfinyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]propan-1-amine |
| SMILES | CC(CNCc1ccc(SC(F)(F)F)cc1)S(C)=O |
| InChI | InChI=1S/C12H16F3NOS2/c1-9(19(2)17)7-16-8-10-3-5-11(6-4-10)18-12(13,14)15/h3-6,9,16H,7-8H2,1-2H3 |
| InChIKey | VNBYPZOXMKHKSJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |