C21H27F3N2O3S — CID 161331358
ethane;N-hydroxy-2-methyl-3-[[4-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]phenyl]methylamino]propanamide (PubChem CID 161331358) has the molecular formula C21H27F3N2O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is ethane;N-hydroxy-2-methyl-3-[[4-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]phenyl]methylamino]propanamide.
| Compound Name | ethane;N-hydroxy-2-methyl-3-[[4-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 161331358 |
| Molecular Formula | C21H27F3N2O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | ethane;N-hydroxy-2-methyl-3-[[4-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]phenyl]methylamino]propanamide |
| SMILES | CC.CC(CNCc1ccc(OCc2ccc(SC(F)(F)F)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C19H21F3N2O3S.C2H6/c1-13(18(25)24-26)10-23-11-14-2-6-16(7-3-14)27-12-15-4-8-17(9-5-15)28-19(20,21)22;1-2/h2-9,13,23,26H,10-12H2,1H3,(H,24,25);1-2H3 |
| InChIKey | VLLODUPQNUSHCY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|