C13H13ClN2 — CID 115766622
5-chloro-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile (PubChem CID 115766622) has the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 5-chloro-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile.
| Compound Name | 5-chloro-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 115766622 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-chloro-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile |
| SMILES | CC1=CCN(c2ccc(Cl)cc2C#N)CC1 |
| InChI | InChI=1S/C13H13ClN2/c1-10-4-6-16(7-5-10)13-3-2-12(14)8-11(13)9-15/h2-4,8H,5-7H2,1H3 |
| InChIKey | BCZZNCIWKQBMSC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|