C23H23N5O3S3 — CID 11577142
6-(1-methylsulfonylpiperidin-4-yl)oxy-N-[4-(1,3-thiazol-2-ylsulfanyl)phenyl]quinazolin-4-amine (PubChem CID 11577142) has the molecular formula C23H23N5O3S3 and a molecular weight of 513.67 g/mol. Its IUPAC name is 6-(1-methylsulfonylpiperidin-4-yl)oxy-N-[4-(1,3-thiazol-2-ylsulfanyl)phenyl]quinazolin-4-amine.
| Compound Name | 6-(1-methylsulfonylpiperidin-4-yl)oxy-N-[4-(1,3-thiazol-2-ylsulfanyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 11577142 |
| Molecular Formula | C23H23N5O3S3 |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 6-(1-methylsulfonylpiperidin-4-yl)oxy-N-[4-(1,3-thiazol-2-ylsulfanyl)phenyl]quinazolin-4-amine |
| SMILES | CS(=O)(=O)N1CCC(Oc2ccc3ncnc(Nc4ccc(Sc5nccs5)cc4)c3c2)CC1 |
| InChI | InChI=1S/C23H23N5O3S3/c1-34(29,30)28-11-8-17(9-12-28)31-18-4-7-21-20(14-18)22(26-15-25-21)27-16-2-5-19(6-3-16)33-23-24-10-13-32-23/h2-7,10,13-15,17H,8-9,11-12H2,1H3,(H,25,26,27) |
| InChIKey | GVTKSUVXHBZNTA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|