C29H27FN4O4S — CID 11642431
N-[3-ethynyl-4-[(3-fluorophenyl)methoxy]phenyl]-6-(1-methylsulfonylpiperidin-4-yl)oxyquinazolin-4-amine (PubChem CID 11642431) has the molecular formula C29H27FN4O4S and a molecular weight of 546.62 g/mol. Its IUPAC name is N-[3-ethynyl-4-[(3-fluorophenyl)methoxy]phenyl]-6-(1-methylsulfonylpiperidin-4-yl)oxyquinazolin-4-amine.
| Compound Name | N-[3-ethynyl-4-[(3-fluorophenyl)methoxy]phenyl]-6-(1-methylsulfonylpiperidin-4-yl)oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 11642431 |
| Molecular Formula | C29H27FN4O4S |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | N-[3-ethynyl-4-[(3-fluorophenyl)methoxy]phenyl]-6-(1-methylsulfonylpiperidin-4-yl)oxyquinazolin-4-amine |
| SMILES | C#Cc1cc(Nc2ncnc3ccc(OC4CCN(S(C)(=O)=O)CC4)cc23)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C29H27FN4O4S/c1-3-21-16-23(7-10-28(21)37-18-20-5-4-6-22(30)15-20)33-29-26-17-25(8-9-27(26)31-19-32-29)38-24-11-13-34(14-12-24)39(2,35)36/h1,4-10,15-17,19,24H,11-14,18H2,2H3,(H,31,32,33) |
| InChIKey | UJYVJSAYWGPWHT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|