C9H16N4O2 — CID 115773650
4-methyl-2-(2-morpholin-4-ylethyl)-1,2,4-triazol-3-one (PubChem CID 115773650) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-methyl-2-(2-morpholin-4-ylethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-methyl-2-(2-morpholin-4-ylethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 115773650 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-methyl-2-(2-morpholin-4-ylethyl)-1,2,4-triazol-3-one |
| SMILES | Cn1cnn(CCN2CCOCC2)c1=O |
| InChI | InChI=1S/C9H16N4O2/c1-11-8-10-13(9(11)14)3-2-12-4-6-15-7-5-12/h8H,2-7H2,1H3 |
| InChIKey | ACGQTWBGOWUWKF-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |