C16H19NO3 — CID 115776317
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-hydroxyethyl)-N-prop-2-enylprop-2-enamide (PubChem CID 115776317) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-hydroxyethyl)-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-hydroxyethyl)-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 115776317 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-hydroxyethyl)-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(CCO)C(=O)/C=C/c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H19NO3/c1-2-8-17(9-10-18)16(19)6-4-13-3-5-15-14(12-13)7-11-20-15/h2-6,12,18H,1,7-11H2/b6-4+ |
| InChIKey | WJQHLBRKJZYUMC-GQCTYLIASA-N |
| XLogP | 1.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|