methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate

C10H15N3O2S — CID 115777411

IUPACmethyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate
SMILESCOC(=O)C1CCC(Nc2ncns2)CC1
InChIInChI=1S/C10H15N3O2S/c1-15-9(14)7-2-4-8(5-3-7)13-10-11-6-12-16-10/h6-8H,2-5H2,1H3,(H,11,12,13)
InChIKeyBXANUMVYMHTZGV-UHFFFAOYSA-N
MW241.32 g/mol
LogP1.68
Rot. Bonds3

About methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate

methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate (PubChem CID 115777411) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate
PubChem CID115777411
Molecular FormulaC10H15N3O2S
Molecular Weight241.32 g/mol
Exact Mass241.09
IUPAC Namemethyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate
SMILESCOC(=O)C1CCC(Nc2ncns2)CC1
InChIInChI=1S/C10H15N3O2S/c1-15-9(14)7-2-4-8(5-3-7)13-10-11-6-12-16-10/h6-8H,2-5H2,1H3,(H,11,12,13)
InChIKeyBXANUMVYMHTZGV-UHFFFAOYSA-N
XLogP1.68
TPSA64.11 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.32
LogP ≤ 51.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate?
The IUPAC name of methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate (CID 115777411) is methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate is COC(=O)C1CCC(Nc2ncns2)CC1.
What is the InChIKey of methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate?
The InChIKey is BXANUMVYMHTZGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S/c1-15-9(14)7-2-4-8(5-3-7)13-10-11-6-12-16-10/h6-8H,2-5H2,1H3,(H,11,12,13).
What are the key properties of methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate?
methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate has a molecular weight of 241.32 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,2,4-thiadiazol-5-ylamino)cyclohexane-1-carboxylate is sourced from PubChem (CID 115777411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).