C11H14BrClO3S — CID 115780199
1-(5-bromo-2-chlorophenyl)-4-methylsulfonylbutan-1-ol (PubChem CID 115780199) has the molecular formula C11H14BrClO3S and a molecular weight of 341.65 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-4-methylsulfonylbutan-1-ol.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-4-methylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 115780199 |
| Molecular Formula | C11H14BrClO3S |
| Molecular Weight | 341.65 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-4-methylsulfonylbutan-1-ol |
| SMILES | CS(=O)(=O)CCCC(O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C11H14BrClO3S/c1-17(15,16)6-2-3-11(14)9-7-8(12)4-5-10(9)13/h4-5,7,11,14H,2-3,6H2,1H3 |
| InChIKey | WACNRBIJVPLBRN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |