C15H21NO3S2 — CID 115784266
1-(2-methylsulfanylphenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone (PubChem CID 115784266) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-(2-methylsulfanylphenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone.
| Compound Name | 1-(2-methylsulfanylphenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone |
|---|---|
| PubChem CID | 115784266 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-(2-methylsulfanylphenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone |
| SMILES | CSc1ccccc1C(=O)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H21NO3S2/c1-20-15-8-4-3-7-13(15)14(17)10-12-6-5-9-16(11-12)21(2,18)19/h3-4,7-8,12H,5-6,9-11H2,1-2H3 |
| InChIKey | QJJAOGVTDHKTJN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |