C14H21NO3S2 — CID 115784268
1-(5-ethylthiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone (PubChem CID 115784268) has the molecular formula C14H21NO3S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone.
| Compound Name | 1-(5-ethylthiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone |
|---|---|
| PubChem CID | 115784268 |
| Molecular Formula | C14H21NO3S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanone |
| SMILES | CCc1ccc(C(=O)CC2CCCN(S(C)(=O)=O)C2)s1 |
| InChI | InChI=1S/C14H21NO3S2/c1-3-12-6-7-14(19-12)13(16)9-11-5-4-8-15(10-11)20(2,17)18/h6-7,11H,3-5,8-10H2,1-2H3 |
| InChIKey | LQNJZCYFINKMDG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |