C17H11F2NO — CID 115790827
2-(2,3-difluorophenyl)-1-quinolin-8-ylethanone (PubChem CID 115790827) has the molecular formula C17H11F2NO and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-1-quinolin-8-ylethanone.
| Compound Name | 2-(2,3-difluorophenyl)-1-quinolin-8-ylethanone |
|---|---|
| PubChem CID | 115790827 |
| Molecular Formula | C17H11F2NO |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(2,3-difluorophenyl)-1-quinolin-8-ylethanone |
| SMILES | O=C(Cc1cccc(F)c1F)c1cccc2cccnc12 |
| InChI | InChI=1S/C17H11F2NO/c18-14-8-2-5-12(16(14)19)10-15(21)13-7-1-4-11-6-3-9-20-17(11)13/h1-9H,10H2 |
| InChIKey | AJHMJCXDHJCBSA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |