C19H18OS — CID 115803448
1-(1-benzothiophen-2-yl)-2-(2,3-dihydro-1H-inden-5-yl)ethanol (PubChem CID 115803448) has the molecular formula C19H18OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-2-(2,3-dihydro-1H-inden-5-yl)ethanol.
| Compound Name | 1-(1-benzothiophen-2-yl)-2-(2,3-dihydro-1H-inden-5-yl)ethanol |
|---|---|
| PubChem CID | 115803448 |
| Molecular Formula | C19H18OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-2-(2,3-dihydro-1H-inden-5-yl)ethanol |
| SMILES | OC(Cc1ccc2c(c1)CCC2)c1cc2ccccc2s1 |
| InChI | InChI=1S/C19H18OS/c20-17(19-12-16-4-1-2-7-18(16)21-19)11-13-8-9-14-5-3-6-15(14)10-13/h1-2,4,7-10,12,17,20H,3,5-6,11H2 |
| InChIKey | LXAKJCZGBHAGAK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |