C16H13F5OS2 — CID 177491448
1-(1-benzothiophen-2-yl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol (PubChem CID 177491448) has the molecular formula C16H13F5OS2 and a molecular weight of 380.40 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol.
| Compound Name | 1-(1-benzothiophen-2-yl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 177491448 |
| Molecular Formula | C16H13F5OS2 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethanol |
| SMILES | OC(Cc1ccc(S(F)(F)(F)(F)F)cc1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H13F5OS2/c17-24(18,19,20,21)13-7-5-11(6-8-13)9-14(22)16-10-12-3-1-2-4-15(12)23-16/h1-8,10,14,22H,9H2 |
| InChIKey | IVOKNOSDXOUKOC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |