C18H18F2O — CID 115803489
1-(2,6-difluorophenyl)-3-(2,3-dihydro-1H-inden-5-yl)propan-2-ol (PubChem CID 115803489) has the molecular formula C18H18F2O and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(2,3-dihydro-1H-inden-5-yl)propan-2-ol.
| Compound Name | 1-(2,6-difluorophenyl)-3-(2,3-dihydro-1H-inden-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 115803489 |
| Molecular Formula | C18H18F2O |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(2,3-dihydro-1H-inden-5-yl)propan-2-ol |
| SMILES | OC(Cc1ccc2c(c1)CCC2)Cc1c(F)cccc1F |
| InChI | InChI=1S/C18H18F2O/c19-17-5-2-6-18(20)16(17)11-15(21)10-12-7-8-13-3-1-4-14(13)9-12/h2,5-9,15,21H,1,3-4,10-11H2 |
| InChIKey | PTGIUKKJDLWPAL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |