C18H18BrF — CID 79454542
5-[3-bromo-2-(2-fluorophenyl)propyl]-2,3-dihydro-1H-indene (PubChem CID 79454542) has the molecular formula C18H18BrF and a molecular weight of 333.24 g/mol. Its IUPAC name is 5-[3-bromo-2-(2-fluorophenyl)propyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[3-bromo-2-(2-fluorophenyl)propyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 79454542 |
| Molecular Formula | C18H18BrF |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 5-[3-bromo-2-(2-fluorophenyl)propyl]-2,3-dihydro-1H-indene |
| SMILES | Fc1ccccc1C(CBr)Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H18BrF/c19-12-16(17-6-1-2-7-18(17)20)11-13-8-9-14-4-3-5-15(14)10-13/h1-2,6-10,16H,3-5,11-12H2 |
| InChIKey | XHFAZNCHIGSHLX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|