C15H12BrF3 — CID 79454466
1-[3-bromo-2-(2-fluorophenyl)propyl]-2,4-difluorobenzene (PubChem CID 79454466) has the molecular formula C15H12BrF3 and a molecular weight of 329.16 g/mol. Its IUPAC name is 1-[3-bromo-2-(2-fluorophenyl)propyl]-2,4-difluorobenzene.
| Compound Name | 1-[3-bromo-2-(2-fluorophenyl)propyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 79454466 |
| Molecular Formula | C15H12BrF3 |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 1-[3-bromo-2-(2-fluorophenyl)propyl]-2,4-difluorobenzene |
| SMILES | Fc1ccc(CC(CBr)c2ccccc2F)c(F)c1 |
| InChI | InChI=1S/C15H12BrF3/c16-9-11(13-3-1-2-4-14(13)18)7-10-5-6-12(17)8-15(10)19/h1-6,8,11H,7,9H2 |
| InChIKey | RSOHLRGEHIQDEM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|