C9H9Br2F — CID 79456002
1-(1,3-dibromopropan-2-yl)-2-fluorobenzene (PubChem CID 79456002) has the molecular formula C9H9Br2F and a molecular weight of 295.98 g/mol. Its IUPAC name is 1-(1,3-dibromopropan-2-yl)-2-fluorobenzene.
| Compound Name | 1-(1,3-dibromopropan-2-yl)-2-fluorobenzene |
|---|---|
| PubChem CID | 79456002 |
| Molecular Formula | C9H9Br2F |
| Molecular Weight | 295.98 g/mol |
| Exact Mass | 293.91 |
| IUPAC Name | 1-(1,3-dibromopropan-2-yl)-2-fluorobenzene |
| SMILES | Fc1ccccc1C(CBr)CBr |
| InChI | InChI=1S/C9H9Br2F/c10-5-7(6-11)8-3-1-2-4-9(8)12/h1-4,7H,5-6H2 |
| InChIKey | BVDKGHXPOZPUAU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.98 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|