C12H24O3S — CID 115806221
1-(3,4-dimethylcyclohexyl)-2-methylsulfonylpropan-1-ol (PubChem CID 115806221) has the molecular formula C12H24O3S and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-2-methylsulfonylpropan-1-ol.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-2-methylsulfonylpropan-1-ol |
|---|---|
| PubChem CID | 115806221 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-2-methylsulfonylpropan-1-ol |
| SMILES | CC1CCC(C(O)C(C)S(C)(=O)=O)CC1C |
| InChI | InChI=1S/C12H24O3S/c1-8-5-6-11(7-9(8)2)12(13)10(3)16(4,14)15/h8-13H,5-7H2,1-4H3 |
| InChIKey | JGUIAVOVMZNMQP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |