C17H25N3O — CID 115806882
2-(3,5-dimethyl-1-adamantyl)-1-(3-methyltriazol-4-yl)ethanone (PubChem CID 115806882) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-1-(3-methyltriazol-4-yl)ethanone.
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-1-(3-methyltriazol-4-yl)ethanone |
|---|---|
| PubChem CID | 115806882 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-1-(3-methyltriazol-4-yl)ethanone |
| SMILES | Cn1nncc1C(=O)CC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C17H25N3O/c1-15-4-12-5-16(2,9-15)11-17(6-12,10-15)7-14(21)13-8-18-19-20(13)3/h8,12H,4-7,9-11H2,1-3H3 |
| InChIKey | WIQCRAXERGWKTH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |