C12H21ClN2O3S — CID 115813292
1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyl-3-methylsulfonylbutan-2-ol (PubChem CID 115813292) has the molecular formula C12H21ClN2O3S and a molecular weight of 308.83 g/mol. Its IUPAC name is 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyl-3-methylsulfonylbutan-2-ol.
| Compound Name | 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyl-3-methylsulfonylbutan-2-ol |
|---|---|
| PubChem CID | 115813292 |
| Molecular Formula | C12H21ClN2O3S |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyl-3-methylsulfonylbutan-2-ol |
| SMILES | CCn1nc(C)c(Cl)c1CC(O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H21ClN2O3S/c1-6-15-9(11(13)8(2)14-15)7-10(16)12(3,4)19(5,17)18/h10,16H,6-7H2,1-5H3 |
| InChIKey | NWPVURHSEDBJJQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |