C19H29NO4Si — CID 11581342
(2S)-2-[(2R,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde (PubChem CID 11581342) has the molecular formula C19H29NO4Si and a molecular weight of 363.53 g/mol. Its IUPAC name is (2S)-2-[(2R,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde.
| Compound Name | (2S)-2-[(2R,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde |
|---|---|
| PubChem CID | 11581342 |
| Molecular Formula | C19H29NO4Si |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (2S)-2-[(2R,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetaldehyde |
| SMILES | CO[C@H]1C(=O)N(Cc2ccccc2)[C@H]1[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H29NO4Si/c1-19(2,3)25(5,6)24-15(13-21)16-17(23-4)18(22)20(16)12-14-10-8-7-9-11-14/h7-11,13,15-17H,12H2,1-6H3/t15-,16+,17-/m1/s1 |
| InChIKey | ZUCZEFXKQNFLHT-IXDOHACOSA-N |
| XLogP | 3.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|